2924.29.43.00 - 3-Ethoxy carbonyl amino phenyl-N-phenyl carbamate (Desmedipham); and Isopropyl-N-(3-chlorophenyl) car-bamate (CIPC)

This HTS category, 2924.29.43.00, specifically covers certain aromatic carbamate pesticides. It includes two key compounds: Desmedipham, which is 3-Ethoxycarbonyl amino phenyl-N-phenyl carbamate, and CIPC, also known as Isopropyl-N-(3-chlorophenyl) carbamate. These substances are classified here due to their chemical structure as derivatives of carbamic acid and their designated use as pesticides.

The distinguishing factor for this category lies in the specific chemical identity and pesticidal application of the covered compounds, differentiating them from other "Other" aromatic cyclic amides and carbamates under 2924.29.47.00. While sibling categories might include other aromatic carbamates not used as pesticides, or those with different functional groups, this subcategory is precisely defined by the named compounds and their function.

As this is a leaf node within the HTS structure, there are no further subcategories to introduce. Classification under 2924.29.43.00 is determined by the presence of Desmedipham or CIPC, or closely related chemical analogs with identical pesticidal uses and structures, as confirmed by chemical analysis or product documentation.